C22H22ClN3O — CID 3216942
N-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)cyclopropanecarboxamide (PubChem CID 3216942) has the molecular formula C22H22ClN3O and a molecular weight of 379.89 g/mol. Its IUPAC name is N-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)cyclopropanecarboxamide.
| Compound Name | N-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 3216942 |
| Molecular Formula | C22H22ClN3O |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | N-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)cyclopropanecarboxamide |
| SMILES | Cc1cc2cc(CN(Cc3cccnc3)C(=O)C3CC3)c(Cl)nc2cc1C |
| InChI | InChI=1S/C22H22ClN3O/c1-14-8-18-10-19(21(23)25-20(18)9-15(14)2)13-26(22(27)17-5-6-17)12-16-4-3-7-24-11-16/h3-4,7-11,17H,5-6,12-13H2,1-2H3 |
| InChIKey | ABWCVBCELFANQU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|