C20H20ClN3O — CID 43813583
N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)acetamide (PubChem CID 43813583) has the molecular formula C20H20ClN3O and a molecular weight of 353.85 g/mol. Its IUPAC name is N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)acetamide.
| Compound Name | N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 43813583 |
| Molecular Formula | C20H20ClN3O |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | N-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)acetamide |
| SMILES | CC(=O)N(Cc1cccnc1)Cc1cc2ccc(C)c(C)c2nc1Cl |
| InChI | InChI=1S/C20H20ClN3O/c1-13-6-7-17-9-18(20(21)23-19(17)14(13)2)12-24(15(3)25)11-16-5-4-8-22-10-16/h4-10H,11-12H2,1-3H3 |
| InChIKey | HPOUMJWRMGDYSA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|