C23H20ClN5O — CID 1383900
N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)pyrazine-2-carboxamide (PubChem CID 1383900) has the molecular formula C23H20ClN5O and a molecular weight of 417.90 g/mol. Its IUPAC name is N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)pyrazine-2-carboxamide.
| Compound Name | N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 1383900 |
| Molecular Formula | C23H20ClN5O |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-(pyridin-3-ylmethyl)pyrazine-2-carboxamide |
| SMILES | Cc1cc(C)c2nc(Cl)c(CN(Cc3cccnc3)C(=O)c3cnccn3)cc2c1 |
| InChI | InChI=1S/C23H20ClN5O/c1-15-8-16(2)21-18(9-15)10-19(22(24)28-21)14-29(13-17-4-3-5-25-11-17)23(30)20-12-26-6-7-27-20/h3-12H,13-14H2,1-2H3 |
| InChIKey | OXGMEWYQRZWYGS-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|