C25H23ClN4O — CID 1459942
1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-3-phenyl-1-(pyridin-3-ylmethyl)urea (PubChem CID 1459942) has the molecular formula C25H23ClN4O and a molecular weight of 430.94 g/mol. Its IUPAC name is 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-3-phenyl-1-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-3-phenyl-1-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 1459942 |
| Molecular Formula | C25H23ClN4O |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-3-phenyl-1-(pyridin-3-ylmethyl)urea |
| SMILES | Cc1cc2cc(CN(Cc3cccnc3)C(=O)Nc3ccccc3)c(Cl)nc2cc1C |
| InChI | InChI=1S/C25H23ClN4O/c1-17-11-20-13-21(24(26)29-23(20)12-18(17)2)16-30(15-19-7-6-10-27-14-19)25(31)28-22-8-4-3-5-9-22/h3-14H,15-16H2,1-2H3,(H,28,31) |
| InChIKey | FNDLEICJQGIRLK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|