C26H25ClN4O — CID 3216893
1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-3-(2-methylphenyl)-1-(pyridin-3-ylmethyl)urea (PubChem CID 3216893) has the molecular formula C26H25ClN4O and a molecular weight of 444.97 g/mol. Its IUPAC name is 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-3-(2-methylphenyl)-1-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-3-(2-methylphenyl)-1-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 3216893 |
| Molecular Formula | C26H25ClN4O |
| Molecular Weight | 444.97 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-3-(2-methylphenyl)-1-(pyridin-3-ylmethyl)urea |
| SMILES | Cc1ccccc1NC(=O)N(Cc1cccnc1)Cc1cc2ccc(C)c(C)c2nc1Cl |
| InChI | InChI=1S/C26H25ClN4O/c1-17-10-11-21-13-22(25(27)30-24(21)19(17)3)16-31(15-20-8-6-12-28-14-20)26(32)29-23-9-5-4-7-18(23)2/h4-14H,15-16H2,1-3H3,(H,29,32) |
| InChIKey | GAVOXURKNXERQU-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.97 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|