C27H25ClFN3O — CID 3216920
1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(2-methylphenyl)urea (PubChem CID 3216920) has the molecular formula C27H25ClFN3O and a molecular weight of 461.97 g/mol. Its IUPAC name is 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(2-methylphenyl)urea.
| Compound Name | 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 3216920 |
| Molecular Formula | C27H25ClFN3O |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(2-methylphenyl)urea |
| SMILES | Cc1cc(C)c2nc(Cl)c(CN(Cc3ccc(F)cc3)C(=O)Nc3ccccc3C)cc2c1 |
| InChI | InChI=1S/C27H25ClFN3O/c1-17-12-19(3)25-21(13-17)14-22(26(28)31-25)16-32(15-20-8-10-23(29)11-9-20)27(33)30-24-7-5-4-6-18(24)2/h4-14H,15-16H2,1-3H3,(H,30,33) |
| InChIKey | ZORQZSKYIOHGPH-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|