C26H30ClN3O — CID 3215116
1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-cyclohexyl-3-(2-methylphenyl)urea (PubChem CID 3215116) has the molecular formula C26H30ClN3O and a molecular weight of 436.00 g/mol. Its IUPAC name is 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-cyclohexyl-3-(2-methylphenyl)urea.
| Compound Name | 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-cyclohexyl-3-(2-methylphenyl)urea |
|---|---|
| PubChem CID | 3215116 |
| Molecular Formula | C26H30ClN3O |
| Molecular Weight | 436.00 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | 1-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-1-cyclohexyl-3-(2-methylphenyl)urea |
| SMILES | Cc1cc(C)c2nc(Cl)c(CN(C(=O)Nc3ccccc3C)C3CCCCC3)cc2c1 |
| InChI | InChI=1S/C26H30ClN3O/c1-17-13-19(3)24-20(14-17)15-21(25(27)29-24)16-30(22-10-5-4-6-11-22)26(31)28-23-12-8-7-9-18(23)2/h7-9,12-15,22H,4-6,10-11,16H2,1-3H3,(H,28,31) |
| InChIKey | OFILKEOAJSAONV-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.00 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|