C19H23ClN2O — CID 1459902
N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclopentylacetamide (PubChem CID 1459902) has the molecular formula C19H23ClN2O and a molecular weight of 330.86 g/mol. Its IUPAC name is N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclopentylacetamide.
| Compound Name | N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 1459902 |
| Molecular Formula | C19H23ClN2O |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclopentylacetamide |
| SMILES | CC(=O)N(Cc1cc2cc(C)cc(C)c2nc1Cl)C1CCCC1 |
| InChI | InChI=1S/C19H23ClN2O/c1-12-8-13(2)18-15(9-12)10-16(19(20)21-18)11-22(14(3)23)17-6-4-5-7-17/h8-10,17H,4-7,11H2,1-3H3 |
| InChIKey | AAGCYCKMIVHKJF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|