C17H21ClN2O2 — CID 3216943
N-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-N-(2-methoxyethyl)acetamide (PubChem CID 3216943) has the molecular formula C17H21ClN2O2 and a molecular weight of 320.82 g/mol. Its IUPAC name is N-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | N-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 3216943 |
| Molecular Formula | C17H21ClN2O2 |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-[(2-chloro-6,7-dimethylquinolin-3-yl)methyl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCN(Cc1cc2cc(C)c(C)cc2nc1Cl)C(C)=O |
| InChI | InChI=1S/C17H21ClN2O2/c1-11-7-14-9-15(10-20(13(3)21)5-6-22-4)17(18)19-16(14)8-12(11)2/h7-9H,5-6,10H2,1-4H3 |
| InChIKey | IQGPFHQHDSZKHU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|