C21H21ClN2O2 — CID 1459732
N-[(2-chloro-8-methylquinolin-3-yl)methyl]-N-cyclopentylfuran-2-carboxamide (PubChem CID 1459732) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is N-[(2-chloro-8-methylquinolin-3-yl)methyl]-N-cyclopentylfuran-2-carboxamide.
| Compound Name | N-[(2-chloro-8-methylquinolin-3-yl)methyl]-N-cyclopentylfuran-2-carboxamide |
|---|---|
| PubChem CID | 1459732 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-[(2-chloro-8-methylquinolin-3-yl)methyl]-N-cyclopentylfuran-2-carboxamide |
| SMILES | Cc1cccc2cc(CN(C(=O)c3ccco3)C3CCCC3)c(Cl)nc12 |
| InChI | InChI=1S/C21H21ClN2O2/c1-14-6-4-7-15-12-16(20(22)23-19(14)15)13-24(17-8-2-3-9-17)21(25)18-10-5-11-26-18/h4-7,10-12,17H,2-3,8-9,13H2,1H3 |
| InChIKey | JLTJOMGCMJIWDL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|