About N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide
N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide (PubChem CID 3215123) has the molecular formula C25H27ClN2O
and a molecular weight of 406.96 g/mol. Its IUPAC name is N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide.
Molecular Properties
| Compound Name | N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide |
| PubChem CID | 3215123 |
| Molecular Formula | C25H27ClN2O |
| Molecular Weight | 406.96 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide |
| SMILES | Cc1cc(C)c2nc(Cl)c(CN(C(=O)c3ccccc3)C3CCCCC3)cc2c1 |
| InChI | InChI=1S/C25H27ClN2O/c1-17-13-18(2)23-20(14-17)15-21(24(26)27-23)16-28(22-11-7-4-8-12-22)25(29)19-9-5-3-6-10-19/h3,5-6,9-10,13-15,22H,4,7-8,11-12,16H2,1-2H3 |
| InChIKey | AXQWMHRFUUPYEO-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.96 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide?
The IUPAC name of N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide (CID 3215123) is N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide.
What is the SMILES notation for N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide?
The canonical SMILES for N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide is Cc1cc(C)c2nc(Cl)c(CN(C(=O)c3ccccc3)C3CCCCC3)cc2c1.
What is the InChIKey of N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide?
The InChIKey is AXQWMHRFUUPYEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27ClN2O/c1-17-13-18(2)23-20(14-17)15-21(24(26)27-23)16-28(22-11-7-4-8-12-22)25(29)19-9-5-3-6-10-19/h3,5-6,9-10,13-15,22H,4,7-8,11-12,16H2,1-2H3.
What are the key properties of N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide?
N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide has a molecular weight of 406.96 g/mol, XLogP of 6.48, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-N-cyclohexylbenzamide is sourced from PubChem (CID 3215123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).