C28H33ClN2O3 — CID 3229743
N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,5-dimethoxy-N-(4-methylcyclohexyl)benzamide (PubChem CID 3229743) has the molecular formula C28H33ClN2O3 and a molecular weight of 481.04 g/mol. Its IUPAC name is N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,5-dimethoxy-N-(4-methylcyclohexyl)benzamide.
| Compound Name | N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,5-dimethoxy-N-(4-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 3229743 |
| Molecular Formula | C28H33ClN2O3 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | N-[(2-chloro-6,8-dimethylquinolin-3-yl)methyl]-3,5-dimethoxy-N-(4-methylcyclohexyl)benzamide |
| SMILES | COc1cc(OC)cc(C(=O)N(Cc2cc3cc(C)cc(C)c3nc2Cl)C2CCC(C)CC2)c1 |
| InChI | InChI=1S/C28H33ClN2O3/c1-17-6-8-23(9-7-17)31(28(32)21-13-24(33-4)15-25(14-21)34-5)16-22-12-20-11-18(2)10-19(3)26(20)30-27(22)29/h10-15,17,23H,6-9,16H2,1-5H3 |
| InChIKey | FUPJEWQAGPADAB-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|