C23H24ClN3O2 — CID 1449416
3-(2-chlorophenyl)-1-cyclopentyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]urea (PubChem CID 1449416) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1-cyclopentyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]urea.
| Compound Name | 3-(2-chlorophenyl)-1-cyclopentyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 1449416 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3-(2-chlorophenyl)-1-cyclopentyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]urea |
| SMILES | Cc1ccc2[nH]c(=O)c(CN(C(=O)Nc3ccccc3Cl)C3CCCC3)cc2c1 |
| InChI | InChI=1S/C23H24ClN3O2/c1-15-10-11-20-16(12-15)13-17(22(28)25-20)14-27(18-6-2-3-7-18)23(29)26-21-9-5-4-8-19(21)24/h4-5,8-13,18H,2-3,6-7,14H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | YKBVCKPWOXGHLC-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |