C25H29N3OS — CID 1374747
1-cyclopentyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-phenylethyl)thiourea (PubChem CID 1374747) has the molecular formula C25H29N3OS and a molecular weight of 419.59 g/mol. Its IUPAC name is 1-cyclopentyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-cyclopentyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 1374747 |
| Molecular Formula | C25H29N3OS |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 1-cyclopentyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-phenylethyl)thiourea |
| SMILES | Cc1ccc2[nH]c(=O)c(CN(C(=S)NCCc3ccccc3)C3CCCC3)cc2c1 |
| InChI | InChI=1S/C25H29N3OS/c1-18-11-12-23-20(15-18)16-21(24(29)27-23)17-28(22-9-5-6-10-22)25(30)26-14-13-19-7-3-2-4-8-19/h2-4,7-8,11-12,15-16,22H,5-6,9-10,13-14,17H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | RYUOQWKNUZPFPN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|