C27H33N3OS — CID 3171469
1-cyclohexyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-phenylethyl)thiourea (PubChem CID 3171469) has the molecular formula C27H33N3OS and a molecular weight of 447.65 g/mol. Its IUPAC name is 1-cyclohexyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-cyclohexyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 3171469 |
| Molecular Formula | C27H33N3OS |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 1-cyclohexyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-phenylethyl)thiourea |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(CN(C(=S)NCCc3ccccc3)C3CCCCC3)cc2c1 |
| InChI | InChI=1S/C27H33N3OS/c1-19-15-20(2)25-22(16-19)17-23(26(31)29-25)18-30(24-11-7-4-8-12-24)27(32)28-14-13-21-9-5-3-6-10-21/h3,5-6,9-10,15-17,24H,4,7-8,11-14,18H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | WROOWFUOXXUCHY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|