C25H29N3OS — CID 1174827
3-benzyl-1-cyclopentyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 1174827) has the molecular formula C25H29N3OS and a molecular weight of 419.59 g/mol. Its IUPAC name is 3-benzyl-1-cyclopentyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 3-benzyl-1-cyclopentyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 1174827 |
| Molecular Formula | C25H29N3OS |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 3-benzyl-1-cyclopentyl-1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | Cc1cc(C)c2[nH]c(=O)c(CN(C(=S)NCc3ccccc3)C3CCCC3)cc2c1 |
| InChI | InChI=1S/C25H29N3OS/c1-17-12-18(2)23-20(13-17)14-21(24(29)27-23)16-28(22-10-6-7-11-22)25(30)26-15-19-8-4-3-5-9-19/h3-5,8-9,12-14,22H,6-7,10-11,15-16H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | MUSDBAZVPIDTDC-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|