C24H27N3OS — CID 1374744
3-benzyl-1-cyclopentyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 1374744) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is 3-benzyl-1-cyclopentyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 3-benzyl-1-cyclopentyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 1374744 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 3-benzyl-1-cyclopentyl-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | Cc1ccc2[nH]c(=O)c(CN(C(=S)NCc3ccccc3)C3CCCC3)cc2c1 |
| InChI | InChI=1S/C24H27N3OS/c1-17-11-12-22-19(13-17)14-20(23(28)26-22)16-27(21-9-5-6-10-21)24(29)25-15-18-7-3-2-4-8-18/h2-4,7-8,11-14,21H,5-6,9-10,15-16H2,1H3,(H,25,29)(H,26,28) |
| InChIKey | CSLUCZWEKIFDTG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|