C25H29N3O2S — CID 1141930
1-cyclopentyl-3-(2,4-dimethylphenyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 1141930) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is 1-cyclopentyl-3-(2,4-dimethylphenyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 1-cyclopentyl-3-(2,4-dimethylphenyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 1141930 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 1-cyclopentyl-3-(2,4-dimethylphenyl)-1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | COc1ccc2[nH]c(=O)c(CN(C(=S)Nc3ccc(C)cc3C)C3CCCC3)cc2c1 |
| InChI | InChI=1S/C25H29N3O2S/c1-16-8-10-22(17(2)12-16)27-25(31)28(20-6-4-5-7-20)15-19-13-18-14-21(30-3)9-11-23(18)26-24(19)29/h8-14,20H,4-7,15H2,1-3H3,(H,26,29)(H,27,31) |
| InChIKey | JTPNWBMXHVSMFZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|