C23H24ClN3S — CID 6498869
1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea (PubChem CID 6498869) has the molecular formula C23H24ClN3S and a molecular weight of 409.99 g/mol. Its IUPAC name is 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 6498869 |
| Molecular Formula | C23H24ClN3S |
| Molecular Weight | 409.99 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)N(Cc1cc2ccc(C)c(C)c2nc1Cl)C1CC1 |
| InChI | InChI=1S/C23H24ClN3S/c1-14-8-9-17-12-18(22(24)26-21(17)16(14)3)13-27(19-10-11-19)23(28)25-20-7-5-4-6-15(20)2/h4-9,12,19H,10-11,13H2,1-3H3,(H,25,28) |
| InChIKey | NXHOTAAPOBUWAD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.99 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|