About 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea
1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea (PubChem CID 6498869) has the molecular formula C23H24ClN3S
and a molecular weight of 409.99 g/mol. Its IUPAC name is 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea.
Molecular Properties
| Compound Name | 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea |
| PubChem CID | 6498869 |
| Molecular Formula | C23H24ClN3S |
| Molecular Weight | 409.99 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)N(Cc1cc2ccc(C)c(C)c2nc1Cl)C1CC1 |
| InChI | InChI=1S/C23H24ClN3S/c1-14-8-9-17-12-18(22(24)26-21(17)16(14)3)13-27(19-10-11-19)23(28)25-20-7-5-4-6-15(20)2/h4-9,12,19H,10-11,13H2,1-3H3,(H,25,28) |
| InChIKey | NXHOTAAPOBUWAD-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.99 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea?
The IUPAC name of 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea (CID 6498869) is 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea.
What is the SMILES notation for 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea?
The canonical SMILES for 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea is Cc1ccccc1NC(=S)N(Cc1cc2ccc(C)c(C)c2nc1Cl)C1CC1.
What is the InChIKey of 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea?
The InChIKey is NXHOTAAPOBUWAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24ClN3S/c1-14-8-9-17-12-18(22(24)26-21(17)16(14)3)13-27(19-10-11-19)23(28)25-20-7-5-4-6-15(20)2/h4-9,12,19H,10-11,13H2,1-3H3,(H,25,28).
What are the key properties of 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea?
1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea has a molecular weight of 409.99 g/mol, XLogP of 6.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-7,8-dimethylquinolin-3-yl)methyl]-1-cyclopropyl-3-(2-methylphenyl)thiourea is sourced from PubChem (CID 6498869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).