C16H17ClN2S2 — CID 4616878
3-(4-chloro-2-methylphenyl)-1-cyclopropyl-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 4616878) has the molecular formula C16H17ClN2S2 and a molecular weight of 336.91 g/mol. Its IUPAC name is 3-(4-chloro-2-methylphenyl)-1-cyclopropyl-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(4-chloro-2-methylphenyl)-1-cyclopropyl-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4616878 |
| Molecular Formula | C16H17ClN2S2 |
| Molecular Weight | 336.91 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | 3-(4-chloro-2-methylphenyl)-1-cyclopropyl-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1cc(Cl)ccc1NC(=S)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C16H17ClN2S2/c1-11-9-12(17)4-7-15(11)18-16(20)19(13-5-6-13)10-14-3-2-8-21-14/h2-4,7-9,13H,5-6,10H2,1H3,(H,18,20) |
| InChIKey | LLWZVTHYYCGBBT-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.91 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|