C20H25ClN2OS2 — CID 4292972
3-(4-chloro-2-methoxy-5-methylphenyl)-1-cyclohexyl-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 4292972) has the molecular formula C20H25ClN2OS2 and a molecular weight of 409.02 g/mol. Its IUPAC name is 3-(4-chloro-2-methoxy-5-methylphenyl)-1-cyclohexyl-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(4-chloro-2-methoxy-5-methylphenyl)-1-cyclohexyl-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4292972 |
| Molecular Formula | C20H25ClN2OS2 |
| Molecular Weight | 409.02 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 3-(4-chloro-2-methoxy-5-methylphenyl)-1-cyclohexyl-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | COc1cc(Cl)c(C)cc1NC(=S)N(Cc1cccs1)C1CCCCC1 |
| InChI | InChI=1S/C20H25ClN2OS2/c1-14-11-18(19(24-2)12-17(14)21)22-20(25)23(13-16-9-6-10-26-16)15-7-4-3-5-8-15/h6,9-12,15H,3-5,7-8,13H2,1-2H3,(H,22,25) |
| InChIKey | WPWYORNMSAWSAY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.02 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|