C24H26N2OS2 — CID 4659898
1-cyclohexyl-3-(4-phenoxyphenyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 4659898) has the molecular formula C24H26N2OS2 and a molecular weight of 422.62 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4-phenoxyphenyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-cyclohexyl-3-(4-phenoxyphenyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4659898 |
| Molecular Formula | C24H26N2OS2 |
| Molecular Weight | 422.62 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | 1-cyclohexyl-3-(4-phenoxyphenyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | S=C(Nc1ccc(Oc2ccccc2)cc1)N(Cc1cccs1)C1CCCCC1 |
| InChI | InChI=1S/C24H26N2OS2/c28-24(26(18-23-12-7-17-29-23)20-8-3-1-4-9-20)25-19-13-15-22(16-14-19)27-21-10-5-2-6-11-21/h2,5-7,10-17,20H,1,3-4,8-9,18H2,(H,25,28) |
| InChIKey | OOZLBXWKTVPVJV-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.62 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|