C23H25N3OS2 — CID 100572115
1-(4-phenoxyphenyl)-3-[1-(thiophen-2-ylmethyl)piperidin-4-yl]thiourea (PubChem CID 100572115) has the molecular formula C23H25N3OS2 and a molecular weight of 423.61 g/mol. Its IUPAC name is 1-(4-phenoxyphenyl)-3-[1-(thiophen-2-ylmethyl)piperidin-4-yl]thiourea.
| Compound Name | 1-(4-phenoxyphenyl)-3-[1-(thiophen-2-ylmethyl)piperidin-4-yl]thiourea |
|---|---|
| PubChem CID | 100572115 |
| Molecular Formula | C23H25N3OS2 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 1-(4-phenoxyphenyl)-3-[1-(thiophen-2-ylmethyl)piperidin-4-yl]thiourea |
| SMILES | S=C(Nc1ccc(Oc2ccccc2)cc1)NC1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C23H25N3OS2/c28-23(25-19-12-14-26(15-13-19)17-22-7-4-16-29-22)24-18-8-10-21(11-9-18)27-20-5-2-1-3-6-20/h1-11,16,19H,12-15,17H2,(H2,24,25,28) |
| InChIKey | BRQFFQNOOSVMAU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|