C19H25N3S2 — CID 100572362
1-(2-ethylphenyl)-3-[1-(thiophen-2-ylmethyl)piperidin-4-yl]thiourea (PubChem CID 100572362) has the molecular formula C19H25N3S2 and a molecular weight of 359.56 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-3-[1-(thiophen-2-ylmethyl)piperidin-4-yl]thiourea.
| Compound Name | 1-(2-ethylphenyl)-3-[1-(thiophen-2-ylmethyl)piperidin-4-yl]thiourea |
|---|---|
| PubChem CID | 100572362 |
| Molecular Formula | C19H25N3S2 |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-(2-ethylphenyl)-3-[1-(thiophen-2-ylmethyl)piperidin-4-yl]thiourea |
| SMILES | CCc1ccccc1NC(=S)NC1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C19H25N3S2/c1-2-15-6-3-4-8-18(15)21-19(23)20-16-9-11-22(12-10-16)14-17-7-5-13-24-17/h3-8,13,16H,2,9-12,14H2,1H3,(H2,20,21,23) |
| InChIKey | RQEJVZUMEPAWMX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|