C24H27N5S — CID 100572511
1-(4-anilinophenyl)-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]thiourea (PubChem CID 100572511) has the molecular formula C24H27N5S and a molecular weight of 417.58 g/mol. Its IUPAC name is 1-(4-anilinophenyl)-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]thiourea.
| Compound Name | 1-(4-anilinophenyl)-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]thiourea |
|---|---|
| PubChem CID | 100572511 |
| Molecular Formula | C24H27N5S |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 1-(4-anilinophenyl)-3-[1-(pyridin-2-ylmethyl)piperidin-4-yl]thiourea |
| SMILES | S=C(Nc1ccc(Nc2ccccc2)cc1)NC1CCN(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C24H27N5S/c30-24(27-21-11-9-20(10-12-21)26-19-6-2-1-3-7-19)28-22-13-16-29(17-14-22)18-23-8-4-5-15-25-23/h1-12,15,22,26H,13-14,16-18H2,(H2,27,28,30) |
| InChIKey | NYTXMLBWXZBXFY-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|