C18H29N3O2S2 — CID 46371529
2-[[cyclohexyl(thiophen-2-ylmethyl)carbamothioyl]amino]-N-(3-methoxypropyl)acetamide (PubChem CID 46371529) has the molecular formula C18H29N3O2S2 and a molecular weight of 383.58 g/mol. Its IUPAC name is 2-[[cyclohexyl(thiophen-2-ylmethyl)carbamothioyl]amino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[[cyclohexyl(thiophen-2-ylmethyl)carbamothioyl]amino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 46371529 |
| Molecular Formula | C18H29N3O2S2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-[[cyclohexyl(thiophen-2-ylmethyl)carbamothioyl]amino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CNC(=S)N(Cc1cccs1)C1CCCCC1 |
| InChI | InChI=1S/C18H29N3O2S2/c1-23-11-6-10-19-17(22)13-20-18(24)21(14-16-9-5-12-25-16)15-7-3-2-4-8-15/h5,9,12,15H,2-4,6-8,10-11,13-14H2,1H3,(H,19,22)(H,20,24) |
| InChIKey | XGUOJWFYKRMORC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|