C22H31ClN3O2S+ — CID 3442996
3-(4-chloro-2-methoxy-5-methylphenyl)-1-(furan-2-ylmethyl)-1-(3-piperidin-1-ium-1-ylpropyl)thiourea (PubChem CID 3442996) has the molecular formula C22H31ClN3O2S+ and a molecular weight of 437.03 g/mol. Its IUPAC name is 3-(4-chloro-2-methoxy-5-methylphenyl)-1-(furan-2-ylmethyl)-1-(3-piperidin-1-ium-1-ylpropyl)thiourea.
| Compound Name | 3-(4-chloro-2-methoxy-5-methylphenyl)-1-(furan-2-ylmethyl)-1-(3-piperidin-1-ium-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3442996 |
| Molecular Formula | C22H31ClN3O2S+ |
| Molecular Weight | 437.03 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 3-(4-chloro-2-methoxy-5-methylphenyl)-1-(furan-2-ylmethyl)-1-(3-piperidin-1-ium-1-ylpropyl)thiourea |
| SMILES | COc1cc(Cl)c(C)cc1NC(=S)N(CCC[NH+]1CCCCC1)Cc1ccco1 |
| InChI | InChI=1S/C22H30ClN3O2S/c1-17-14-20(21(27-2)15-19(17)23)24-22(29)26(16-18-8-6-13-28-18)12-7-11-25-9-4-3-5-10-25/h6,8,13-15H,3-5,7,9-12,16H2,1-2H3,(H,24,29)/p+1 |
| InChIKey | AVKLDXCPGPOSGP-UHFFFAOYSA-O |
| XLogP | 3.91 |
| TPSA | 42.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.03 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|