C23H34N3OS+ — CID 4097993
1-[2-(azepan-1-ium-1-yl)ethyl]-3-(2-ethyl-6-methylphenyl)-1-(furan-2-ylmethyl)thiourea (PubChem CID 4097993) has the molecular formula C23H34N3OS+ and a molecular weight of 400.61 g/mol. Its IUPAC name is 1-[2-(azepan-1-ium-1-yl)ethyl]-3-(2-ethyl-6-methylphenyl)-1-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[2-(azepan-1-ium-1-yl)ethyl]-3-(2-ethyl-6-methylphenyl)-1-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4097993 |
| Molecular Formula | C23H34N3OS+ |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 1-[2-(azepan-1-ium-1-yl)ethyl]-3-(2-ethyl-6-methylphenyl)-1-(furan-2-ylmethyl)thiourea |
| SMILES | CCc1cccc(C)c1NC(=S)N(CC[NH+]1CCCCCC1)Cc1ccco1 |
| InChI | InChI=1S/C23H33N3OS/c1-3-20-11-8-10-19(2)22(20)24-23(28)26(18-21-12-9-17-27-21)16-15-25-13-6-4-5-7-14-25/h8-12,17H,3-7,13-16,18H2,1-2H3,(H,24,28)/p+1 |
| InChIKey | VEUSMNPZLZRPCJ-UHFFFAOYSA-O |
| XLogP | 3.81 |
| TPSA | 32.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|