C21H30N3O2S+ — CID 4275858
1-[2-(azepan-1-ium-1-yl)ethyl]-1-(furan-2-ylmethyl)-3-(4-methoxyphenyl)thiourea (PubChem CID 4275858) has the molecular formula C21H30N3O2S+ and a molecular weight of 388.56 g/mol. Its IUPAC name is 1-[2-(azepan-1-ium-1-yl)ethyl]-1-(furan-2-ylmethyl)-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[2-(azepan-1-ium-1-yl)ethyl]-1-(furan-2-ylmethyl)-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 4275858 |
| Molecular Formula | C21H30N3O2S+ |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 1-[2-(azepan-1-ium-1-yl)ethyl]-1-(furan-2-ylmethyl)-3-(4-methoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)N(CC[NH+]2CCCCCC2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C21H29N3O2S/c1-25-19-10-8-18(9-11-19)22-21(27)24(17-20-7-6-16-26-20)15-14-23-12-4-2-3-5-13-23/h6-11,16H,2-5,12-15,17H2,1H3,(H,22,27)/p+1 |
| InChIKey | WAEJDFICMZGGLU-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 42.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|