C23H34N3OS+ — CID 4257416
3-(3,4-dimethylphenyl)-1-(furan-2-ylmethyl)-1-[3-(3-methylpiperidin-1-ium-1-yl)propyl]thiourea (PubChem CID 4257416) has the molecular formula C23H34N3OS+ and a molecular weight of 400.61 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-(furan-2-ylmethyl)-1-[3-(3-methylpiperidin-1-ium-1-yl)propyl]thiourea.
| Compound Name | 3-(3,4-dimethylphenyl)-1-(furan-2-ylmethyl)-1-[3-(3-methylpiperidin-1-ium-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 4257416 |
| Molecular Formula | C23H34N3OS+ |
| Molecular Weight | 400.61 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-(furan-2-ylmethyl)-1-[3-(3-methylpiperidin-1-ium-1-yl)propyl]thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCC[NH+]2CCCC(C)C2)Cc2ccco2)cc1C |
| InChI | InChI=1S/C23H33N3OS/c1-18-7-4-11-25(16-18)12-6-13-26(17-22-8-5-14-27-22)23(28)24-21-10-9-19(2)20(3)15-21/h5,8-10,14-15,18H,4,6-7,11-13,16-17H2,1-3H3,(H,24,28)/p+1 |
| InChIKey | ZSEWKXHIBIZWFF-UHFFFAOYSA-O |
| XLogP | 3.80 |
| TPSA | 32.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.61 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|