C22H31ClN3S2+ — CID 3605074
3-(3-chloro-4-methylphenyl)-1-[3-(4-methylpiperidin-1-ium-1-yl)propyl]-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 3605074) has the molecular formula C22H31ClN3S2+ and a molecular weight of 437.10 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-1-[3-(4-methylpiperidin-1-ium-1-yl)propyl]-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 3-(3-chloro-4-methylphenyl)-1-[3-(4-methylpiperidin-1-ium-1-yl)propyl]-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3605074 |
| Molecular Formula | C22H31ClN3S2+ |
| Molecular Weight | 437.10 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-1-[3-(4-methylpiperidin-1-ium-1-yl)propyl]-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(CCC[NH+]2CCC(C)CC2)Cc2cccs2)cc1Cl |
| InChI | InChI=1S/C22H30ClN3S2/c1-17-8-12-25(13-9-17)10-4-11-26(16-20-5-3-14-28-20)22(27)24-19-7-6-18(2)21(23)15-19/h3,5-7,14-15,17H,4,8-13,16H2,1-2H3,(H,24,27)/p+1 |
| InChIKey | XUKVRZKMUMFMIH-UHFFFAOYSA-O |
| XLogP | 4.61 |
| TPSA | 19.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.10 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|