C23H33N3OS — CID 4086738
3-(2-ethylphenyl)-1-(furan-2-ylmethyl)-1-[3-(3-methylpiperidin-1-yl)propyl]thiourea (PubChem CID 4086738) has the molecular formula C23H33N3OS and a molecular weight of 399.60 g/mol. Its IUPAC name is 3-(2-ethylphenyl)-1-(furan-2-ylmethyl)-1-[3-(3-methylpiperidin-1-yl)propyl]thiourea.
| Compound Name | 3-(2-ethylphenyl)-1-(furan-2-ylmethyl)-1-[3-(3-methylpiperidin-1-yl)propyl]thiourea |
|---|---|
| PubChem CID | 4086738 |
| Molecular Formula | C23H33N3OS |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 3-(2-ethylphenyl)-1-(furan-2-ylmethyl)-1-[3-(3-methylpiperidin-1-yl)propyl]thiourea |
| SMILES | CCc1ccccc1NC(=S)N(CCCN1CCCC(C)C1)Cc1ccco1 |
| InChI | InChI=1S/C23H33N3OS/c1-3-20-10-4-5-12-22(20)24-23(28)26(18-21-11-7-16-27-21)15-8-14-25-13-6-9-19(2)17-25/h4-5,7,10-12,16,19H,3,6,8-9,13-15,17-18H2,1-2H3,(H,24,28) |
| InChIKey | UNJLIBLCOCJVRT-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|