C21H28ClN3O2S — CID 3617789
3-(4-chloro-2-methoxy-5-methylphenyl)-1-(furan-2-ylmethyl)-1-(3-pyrrolidin-1-ylpropyl)thiourea (PubChem CID 3617789) has the molecular formula C21H28ClN3O2S and a molecular weight of 421.99 g/mol. Its IUPAC name is 3-(4-chloro-2-methoxy-5-methylphenyl)-1-(furan-2-ylmethyl)-1-(3-pyrrolidin-1-ylpropyl)thiourea.
| Compound Name | 3-(4-chloro-2-methoxy-5-methylphenyl)-1-(furan-2-ylmethyl)-1-(3-pyrrolidin-1-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3617789 |
| Molecular Formula | C21H28ClN3O2S |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-(4-chloro-2-methoxy-5-methylphenyl)-1-(furan-2-ylmethyl)-1-(3-pyrrolidin-1-ylpropyl)thiourea |
| SMILES | COc1cc(Cl)c(C)cc1NC(=S)N(CCCN1CCCC1)Cc1ccco1 |
| InChI | InChI=1S/C21H28ClN3O2S/c1-16-13-19(20(26-2)14-18(16)22)23-21(28)25(15-17-7-5-12-27-17)11-6-10-24-8-3-4-9-24/h5,7,12-14H,3-4,6,8-11,15H2,1-2H3,(H,23,28) |
| InChIKey | GMESPVSBMJYJMW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 40.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|