C17H17Cl2N3O2 — CID 113055305
N-[2-[acetyl(pyridin-3-ylmethyl)amino]ethyl]-3,4-dichlorobenzamide (PubChem CID 113055305) has the molecular formula C17H17Cl2N3O2 and a molecular weight of 366.25 g/mol. Its IUPAC name is N-[2-[acetyl(pyridin-3-ylmethyl)amino]ethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-[acetyl(pyridin-3-ylmethyl)amino]ethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 113055305 |
| Molecular Formula | C17H17Cl2N3O2 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[2-[acetyl(pyridin-3-ylmethyl)amino]ethyl]-3,4-dichlorobenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccc(Cl)c(Cl)c1)Cc1cccnc1 |
| InChI | InChI=1S/C17H17Cl2N3O2/c1-12(23)22(11-13-3-2-6-20-10-13)8-7-21-17(24)14-4-5-15(18)16(19)9-14/h2-6,9-10H,7-8,11H2,1H3,(H,21,24) |
| InChIKey | MSSFSFLIBLBRTP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |