C22H19Cl2N3O3 — CID 78889118
3,4-dichloro-N-[2-[[3-(pyridin-3-ylmethoxy)benzoyl]amino]ethyl]benzamide (PubChem CID 78889118) has the molecular formula C22H19Cl2N3O3 and a molecular weight of 444.32 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[[3-(pyridin-3-ylmethoxy)benzoyl]amino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[[3-(pyridin-3-ylmethoxy)benzoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 78889118 |
| Molecular Formula | C22H19Cl2N3O3 |
| Molecular Weight | 444.32 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 3,4-dichloro-N-[2-[[3-(pyridin-3-ylmethoxy)benzoyl]amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccc(Cl)c(Cl)c1)c1cccc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C22H19Cl2N3O3/c23-19-7-6-17(12-20(19)24)22(29)27-10-9-26-21(28)16-4-1-5-18(11-16)30-14-15-3-2-8-25-13-15/h1-8,11-13H,9-10,14H2,(H,26,28)(H,27,29) |
| InChIKey | LPUZFRFQZZDPHM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|