C21H17Cl2N3O3 — CID 60520711
3,4-dichloro-N-[2-oxo-2-[3-(pyridin-3-ylmethoxy)anilino]ethyl]benzamide (PubChem CID 60520711) has the molecular formula C21H17Cl2N3O3 and a molecular weight of 430.29 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-oxo-2-[3-(pyridin-3-ylmethoxy)anilino]ethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-oxo-2-[3-(pyridin-3-ylmethoxy)anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 60520711 |
| Molecular Formula | C21H17Cl2N3O3 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 3,4-dichloro-N-[2-oxo-2-[3-(pyridin-3-ylmethoxy)anilino]ethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)c(Cl)c1)Nc1cccc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C21H17Cl2N3O3/c22-18-7-6-15(9-19(18)23)21(28)25-12-20(27)26-16-4-1-5-17(10-16)29-13-14-3-2-8-24-11-14/h1-11H,12-13H2,(H,25,28)(H,26,27) |
| InChIKey | LJVNQOZGRJVONM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |