C26H22N2O2 — CID 52655964
2-(4-phenylphenyl)-N-[3-(pyridin-3-ylmethoxy)phenyl]acetamide (PubChem CID 52655964) has the molecular formula C26H22N2O2 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-(4-phenylphenyl)-N-[3-(pyridin-3-ylmethoxy)phenyl]acetamide.
| Compound Name | 2-(4-phenylphenyl)-N-[3-(pyridin-3-ylmethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 52655964 |
| Molecular Formula | C26H22N2O2 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 2-(4-phenylphenyl)-N-[3-(pyridin-3-ylmethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)Nc1cccc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C26H22N2O2/c29-26(16-20-11-13-23(14-12-20)22-7-2-1-3-8-22)28-24-9-4-10-25(17-24)30-19-21-6-5-15-27-18-21/h1-15,17-18H,16,19H2,(H,28,29) |
| InChIKey | FMDYURZTMSFSOO-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |