C23H21N5O3 — CID 47091227
N-[2-[[3-(pyridin-3-ylmethoxy)benzoyl]amino]ethyl]-1H-indazole-3-carboxamide (PubChem CID 47091227) has the molecular formula C23H21N5O3 and a molecular weight of 415.45 g/mol. Its IUPAC name is N-[2-[[3-(pyridin-3-ylmethoxy)benzoyl]amino]ethyl]-1H-indazole-3-carboxamide.
| Compound Name | N-[2-[[3-(pyridin-3-ylmethoxy)benzoyl]amino]ethyl]-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 47091227 |
| Molecular Formula | C23H21N5O3 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | N-[2-[[3-(pyridin-3-ylmethoxy)benzoyl]amino]ethyl]-1H-indazole-3-carboxamide |
| SMILES | O=C(NCCNC(=O)c1n[nH]c2ccccc12)c1cccc(OCc2cccnc2)c1 |
| InChI | InChI=1S/C23H21N5O3/c29-22(17-6-3-7-18(13-17)31-15-16-5-4-10-24-14-16)25-11-12-26-23(30)21-19-8-1-2-9-20(19)27-28-21/h1-10,13-14H,11-12,15H2,(H,25,29)(H,26,30)(H,27,28) |
| InChIKey | GYQMUHYPBDLHMH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|