C18H19Cl2NO3 — CID 8815252
3-[(3,4-dichlorophenyl)methoxy]-N-(3-methoxypropyl)benzamide (PubChem CID 8815252) has the molecular formula C18H19Cl2NO3 and a molecular weight of 368.26 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methoxy]-N-(3-methoxypropyl)benzamide.
| Compound Name | 3-[(3,4-dichlorophenyl)methoxy]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 8815252 |
| Molecular Formula | C18H19Cl2NO3 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methoxy]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1cccc(OCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C18H19Cl2NO3/c1-23-9-3-8-21-18(22)14-4-2-5-15(11-14)24-12-13-6-7-16(19)17(20)10-13/h2,4-7,10-11H,3,8-9,12H2,1H3,(H,21,22) |
| InChIKey | SPRKCTICNNMZDI-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|