C19H23Cl2N2O2+ — CID 8815091
3-[[3-[(3,4-dichlorophenyl)methoxy]benzoyl]amino]propyl-dimethylazanium (PubChem CID 8815091) has the molecular formula C19H23Cl2N2O2+ and a molecular weight of 382.31 g/mol. Its IUPAC name is 3-[[3-[(3,4-dichlorophenyl)methoxy]benzoyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[3-[(3,4-dichlorophenyl)methoxy]benzoyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 8815091 |
| Molecular Formula | C19H23Cl2N2O2+ |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-[[3-[(3,4-dichlorophenyl)methoxy]benzoyl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNC(=O)c1cccc(OCc2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H22Cl2N2O2/c1-23(2)10-4-9-22-19(24)15-5-3-6-16(12-15)25-13-14-7-8-17(20)18(21)11-14/h3,5-8,11-12H,4,9-10,13H2,1-2H3,(H,22,24)/p+1 |
| InChIKey | UYQZBFNLQQISBR-UHFFFAOYSA-O |
| XLogP | 2.84 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|