C21H22ClN3O2 — CID 19327741
3-[(3-chlorophenoxy)methyl]-N-[3-(5-methylpyrazol-1-yl)propyl]benzamide (PubChem CID 19327741) has the molecular formula C21H22ClN3O2 and a molecular weight of 383.88 g/mol. Its IUPAC name is 3-[(3-chlorophenoxy)methyl]-N-[3-(5-methylpyrazol-1-yl)propyl]benzamide.
| Compound Name | 3-[(3-chlorophenoxy)methyl]-N-[3-(5-methylpyrazol-1-yl)propyl]benzamide |
|---|---|
| PubChem CID | 19327741 |
| Molecular Formula | C21H22ClN3O2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 3-[(3-chlorophenoxy)methyl]-N-[3-(5-methylpyrazol-1-yl)propyl]benzamide |
| SMILES | Cc1ccnn1CCCNC(=O)c1cccc(COc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C21H22ClN3O2/c1-16-9-11-24-25(16)12-4-10-23-21(26)18-6-2-5-17(13-18)15-27-20-8-3-7-19(22)14-20/h2-3,5-9,11,13-14H,4,10,12,15H2,1H3,(H,23,26) |
| InChIKey | NQHQHDGMMFYYLF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|