C13H20ClN2O+ — CID 2261401
3-[(3-chloro-4-methylbenzoyl)amino]propyl-dimethylazanium (PubChem CID 2261401) has the molecular formula C13H20ClN2O+ and a molecular weight of 255.77 g/mol. Its IUPAC name is 3-[(3-chloro-4-methylbenzoyl)amino]propyl-dimethylazanium.
| Compound Name | 3-[(3-chloro-4-methylbenzoyl)amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 2261401 |
| Molecular Formula | C13H20ClN2O+ |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-[(3-chloro-4-methylbenzoyl)amino]propyl-dimethylazanium |
| SMILES | Cc1ccc(C(=O)NCCC[NH+](C)C)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O/c1-10-5-6-11(9-12(10)14)13(17)15-7-4-8-16(2)3/h5-6,9H,4,7-8H2,1-3H3,(H,15,17)/p+1 |
| InChIKey | CJUKRGFRGSBLBR-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|