C15H14ClN3O4 — CID 75435792
3-chloro-N-(2-hydroxyethyl)-5-nitro-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 75435792) has the molecular formula C15H14ClN3O4 and a molecular weight of 335.75 g/mol. Its IUPAC name is 3-chloro-N-(2-hydroxyethyl)-5-nitro-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 3-chloro-N-(2-hydroxyethyl)-5-nitro-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 75435792 |
| Molecular Formula | C15H14ClN3O4 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 3-chloro-N-(2-hydroxyethyl)-5-nitro-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | O=C(c1cc(Cl)cc([N+](=O)[O-])c1)N(CCO)Cc1cccnc1 |
| InChI | InChI=1S/C15H14ClN3O4/c16-13-6-12(7-14(8-13)19(22)23)15(21)18(4-5-20)10-11-2-1-3-17-9-11/h1-3,6-9,20H,4-5,10H2 |
| InChIKey | AEXJSPOLJMZEGZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 96.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|