C11H14N2O2 — CID 166414550
N-(2-hydroxyethyl)-N-(pyridin-3-ylmethyl)prop-2-enamide (PubChem CID 166414550) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N-(pyridin-3-ylmethyl)prop-2-enamide.
| Compound Name | N-(2-hydroxyethyl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 166414550 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N-(2-hydroxyethyl)-N-(pyridin-3-ylmethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CCO)Cc1cccnc1 |
| InChI | InChI=1S/C11H14N2O2/c1-2-11(15)13(6-7-14)9-10-4-3-5-12-8-10/h2-5,8,14H,1,6-7,9H2 |
| InChIKey | LNHDDIIBFLUHHV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|