C19H22N2O — CID 154880665
N-[(3,4-dimethylphenyl)methyl]-N-(2-pyridin-3-ylethyl)prop-2-enamide (PubChem CID 154880665) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is N-[(3,4-dimethylphenyl)methyl]-N-(2-pyridin-3-ylethyl)prop-2-enamide.
| Compound Name | N-[(3,4-dimethylphenyl)methyl]-N-(2-pyridin-3-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 154880665 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-[(3,4-dimethylphenyl)methyl]-N-(2-pyridin-3-ylethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CCc1cccnc1)Cc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H22N2O/c1-4-19(22)21(11-9-17-6-5-10-20-13-17)14-18-8-7-15(2)16(3)12-18/h4-8,10,12-13H,1,9,11,14H2,2-3H3 |
| InChIKey | PAZRNJCWNIYUBL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|