C18H18Cl2N2O2 — CID 169304212
N-[2-(3,4-dichlorophenyl)ethyl]-N-(2-hydroxy-2-pyridin-3-ylethyl)prop-2-enamide (PubChem CID 169304212) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is N-[2-(3,4-dichlorophenyl)ethyl]-N-(2-hydroxy-2-pyridin-3-ylethyl)prop-2-enamide.
| Compound Name | N-[2-(3,4-dichlorophenyl)ethyl]-N-(2-hydroxy-2-pyridin-3-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 169304212 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N-[2-(3,4-dichlorophenyl)ethyl]-N-(2-hydroxy-2-pyridin-3-ylethyl)prop-2-enamide |
| SMILES | C=CC(=O)N(CCc1ccc(Cl)c(Cl)c1)CC(O)c1cccnc1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-2-18(24)22(12-17(23)14-4-3-8-21-11-14)9-7-13-5-6-15(19)16(20)10-13/h2-6,8,10-11,17,23H,1,7,9,12H2 |
| InChIKey | HWUJZEQDZCQLGH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|