C33H34N2O5 — CID 22171568
tert-butyl N-[2-[4-(4-formyl-3-phenoxyphenyl)phenyl]ethyl]-N-(2-hydroxy-2-pyridin-3-ylethyl)carbamate (PubChem CID 22171568) has the molecular formula C33H34N2O5 and a molecular weight of 538.64 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(4-formyl-3-phenoxyphenyl)phenyl]ethyl]-N-(2-hydroxy-2-pyridin-3-ylethyl)carbamate.
| Compound Name | tert-butyl N-[2-[4-(4-formyl-3-phenoxyphenyl)phenyl]ethyl]-N-(2-hydroxy-2-pyridin-3-ylethyl)carbamate |
|---|---|
| PubChem CID | 22171568 |
| Molecular Formula | C33H34N2O5 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | tert-butyl N-[2-[4-(4-formyl-3-phenoxyphenyl)phenyl]ethyl]-N-(2-hydroxy-2-pyridin-3-ylethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCc1ccc(-c2ccc(C=O)c(Oc3ccccc3)c2)cc1)CC(O)c1cccnc1 |
| InChI | InChI=1S/C33H34N2O5/c1-33(2,3)40-32(38)35(22-30(37)27-8-7-18-34-21-27)19-17-24-11-13-25(14-12-24)26-15-16-28(23-36)31(20-26)39-29-9-5-4-6-10-29/h4-16,18,20-21,23,30,37H,17,19,22H2,1-3H3 |
| InChIKey | WANAYLWOYZJVNJ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|