C37H48N4O5S2 — CID 101066003
tert-butyl N-[(2R)-2-hydroxy-2-pyridin-3-ylethyl]-N-[2-[4-[[4-(4-octyl-1,3-thiazol-2-yl)phenyl]sulfonylamino]phenyl]ethyl]carbamate (PubChem CID 101066003) has the molecular formula C37H48N4O5S2 and a molecular weight of 692.95 g/mol. Its IUPAC name is tert-butyl N-[(2R)-2-hydroxy-2-pyridin-3-ylethyl]-N-[2-[4-[[4-(4-octyl-1,3-thiazol-2-yl)phenyl]sulfonylamino]phenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-2-hydroxy-2-pyridin-3-ylethyl]-N-[2-[4-[[4-(4-octyl-1,3-thiazol-2-yl)phenyl]sulfonylamino]phenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 101066003 |
| Molecular Formula | C37H48N4O5S2 |
| Molecular Weight | 692.95 g/mol |
| Exact Mass | 692.31 |
| IUPAC Name | tert-butyl N-[(2R)-2-hydroxy-2-pyridin-3-ylethyl]-N-[2-[4-[[4-(4-octyl-1,3-thiazol-2-yl)phenyl]sulfonylamino]phenyl]ethyl]carbamate |
| SMILES | CCCCCCCCc1csc(-c2ccc(S(=O)(=O)Nc3ccc(CCN(C[C@H](O)c4cccnc4)C(=O)OC(C)(C)C)cc3)cc2)n1 |
| InChI | InChI=1S/C37H48N4O5S2/c1-5-6-7-8-9-10-13-32-27-47-35(39-32)29-16-20-33(21-17-29)48(44,45)40-31-18-14-28(15-19-31)22-24-41(36(43)46-37(2,3)4)26-34(42)30-12-11-23-38-25-30/h11-12,14-21,23,25,27,34,40,42H,5-10,13,22,24,26H2,1-4H3/t34-/m0/s1 |
| InChIKey | AZSXOLRVNGJEFX-UMSFTDKQSA-N |
| XLogP | 8.42 |
| TPSA | 121.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.95 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|