C33H43N5O3S2 — CID 100970830
N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-4-[methyl-(4-octyl-1,3-thiazol-2-yl)amino]benzenesulfonamide (PubChem CID 100970830) has the molecular formula C33H43N5O3S2 and a molecular weight of 621.87 g/mol. Its IUPAC name is N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-4-[methyl-(4-octyl-1,3-thiazol-2-yl)amino]benzenesulfonamide.
| Compound Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-4-[methyl-(4-octyl-1,3-thiazol-2-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 100970830 |
| Molecular Formula | C33H43N5O3S2 |
| Molecular Weight | 621.87 g/mol |
| Exact Mass | 621.28 |
| IUPAC Name | N-[4-[2-[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]ethyl]phenyl]-4-[methyl-(4-octyl-1,3-thiazol-2-yl)amino]benzenesulfonamide |
| SMILES | CCCCCCCCc1csc(N(C)c2ccc(S(=O)(=O)Nc3ccc(CCNC[C@H](O)c4cccnc4)cc3)cc2)n1 |
| InChI | InChI=1S/C33H43N5O3S2/c1-3-4-5-6-7-8-11-29-25-42-33(36-29)38(2)30-16-18-31(19-17-30)43(40,41)37-28-14-12-26(13-15-28)20-22-35-24-32(39)27-10-9-21-34-23-27/h9-10,12-19,21,23,25,32,35,37,39H,3-8,11,20,22,24H2,1-2H3/t32-/m0/s1 |
| InChIKey | DFTRSITVEVSHGD-YTTGMZPUSA-N |
| XLogP | 6.88 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.87 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|