C29H34N4O3S2 — CID 19420610
N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]-4-(2-pentyl-1,3-thiazol-5-yl)benzenesulfonamide (PubChem CID 19420610) has the molecular formula C29H34N4O3S2 and a molecular weight of 550.75 g/mol. Its IUPAC name is N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]-4-(2-pentyl-1,3-thiazol-5-yl)benzenesulfonamide.
| Compound Name | N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]-4-(2-pentyl-1,3-thiazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 19420610 |
| Molecular Formula | C29H34N4O3S2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | N-[4-[2-[(2-hydroxy-2-pyridin-3-ylethyl)amino]ethyl]phenyl]-4-(2-pentyl-1,3-thiazol-5-yl)benzenesulfonamide |
| SMILES | CCCCCc1ncc(-c2ccc(S(=O)(=O)Nc3ccc(CCNCC(O)c4cccnc4)cc3)cc2)s1 |
| InChI | InChI=1S/C29H34N4O3S2/c1-2-3-4-7-29-32-21-28(37-29)23-10-14-26(15-11-23)38(35,36)33-25-12-8-22(9-13-25)16-18-31-20-27(34)24-6-5-17-30-19-24/h5-6,8-15,17,19,21,27,31,33-34H,2-4,7,16,18,20H2,1H3 |
| InChIKey | AUCNOZNUPUQIKL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|